C31H48N4O4 — CID 19930259
1-N,3-N-bis[3-(dimethylamino)propyl]-5-methoxy-4-(6-phenylhexoxy)benzene-1,3-dicarboxamide (PubChem CID 19930259) has the molecular formula C31H48N4O4 and a molecular weight of 540.75 g/mol. Its IUPAC name is 1-N,3-N-bis[3-(dimethylamino)propyl]-5-methoxy-4-(6-phenylhexoxy)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[3-(dimethylamino)propyl]-5-methoxy-4-(6-phenylhexoxy)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19930259 |
| Molecular Formula | C31H48N4O4 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | 1-N,3-N-bis[3-(dimethylamino)propyl]-5-methoxy-4-(6-phenylhexoxy)benzene-1,3-dicarboxamide |
| SMILES | COc1cc(C(=O)NCCCN(C)C)cc(C(=O)NCCCN(C)C)c1OCCCCCCc1ccccc1 |
| InChI | InChI=1S/C31H48N4O4/c1-34(2)20-13-18-32-30(36)26-23-27(31(37)33-19-14-21-35(3)4)29(28(24-26)38-5)39-22-12-7-6-9-15-25-16-10-8-11-17-25/h8,10-11,16-17,23-24H,6-7,9,12-15,18-22H2,1-5H3,(H,32,36)(H,33,37) |
| InChIKey | AFDABYPQANBNPX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|