C26H33NO6 — CID 131988427
1-[2-[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]ethoxymethyl]cyclopropane-1-carboxylic acid (PubChem CID 131988427) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is 1-[2-[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]ethoxymethyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[2-[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]ethoxymethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 131988427 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 1-[2-[(3,5-dimethoxy-4-methylbenzoyl)-(3-phenylpropyl)amino]ethoxymethyl]cyclopropane-1-carboxylic acid |
| SMILES | COc1cc(C(=O)N(CCCc2ccccc2)CCOCC2(C(=O)O)CC2)cc(OC)c1C |
| InChI | InChI=1S/C26H33NO6/c1-19-22(31-2)16-21(17-23(19)32-3)24(28)27(13-7-10-20-8-5-4-6-9-20)14-15-33-18-26(11-12-26)25(29)30/h4-6,8-9,16-17H,7,10-15,18H2,1-3H3,(H,29,30) |
| InChIKey | GZPJWJRLUKYBDN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|