C21H32F2NO7P — CID 10648362
benzyl (2R,3R)-4-diethoxyphosphoryl-4,4-difluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 10648362) has the molecular formula C21H32F2NO7P and a molecular weight of 479.46 g/mol. Its IUPAC name is benzyl (2R,3R)-4-diethoxyphosphoryl-4,4-difluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | benzyl (2R,3R)-4-diethoxyphosphoryl-4,4-difluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 10648362 |
| Molecular Formula | C21H32F2NO7P |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | benzyl (2R,3R)-4-diethoxyphosphoryl-4,4-difluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H](C)[C@@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H32F2NO7P/c1-7-29-32(27,30-8-2)21(22,23)15(3)17(24-19(26)31-20(4,5)6)18(25)28-14-16-12-10-9-11-13-16/h9-13,15,17H,7-8,14H2,1-6H3,(H,24,26)/t15-,17-/m1/s1 |
| InChIKey | OWNASNFQWFSFTO-NVXWUHKLSA-N |
| XLogP | 5.12 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|