C24H27F3NO6P — CID 75529777
butan-2-yloxy-[1,1,1-trifluoro-5-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)pent-4-yn-2-yl]phosphinic acid (PubChem CID 75529777) has the molecular formula C24H27F3NO6P and a molecular weight of 513.45 g/mol. Its IUPAC name is butan-2-yloxy-[1,1,1-trifluoro-5-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)pent-4-yn-2-yl]phosphinic acid.
| Compound Name | butan-2-yloxy-[1,1,1-trifluoro-5-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)pent-4-yn-2-yl]phosphinic acid |
|---|---|
| PubChem CID | 75529777 |
| Molecular Formula | C24H27F3NO6P |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | butan-2-yloxy-[1,1,1-trifluoro-5-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)pent-4-yn-2-yl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(CC#Cc1ccc(OC)cc1)(NC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H27F3NO6P/c1-4-18(2)34-35(30,31)23(24(25,26)27,16-8-11-19-12-14-21(32-3)15-13-19)28-22(29)33-17-20-9-6-5-7-10-20/h5-7,9-10,12-15,18H,4,16-17H2,1-3H3,(H,28,29)(H,30,31) |
| InChIKey | HSNDDJFOXFFRPJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|