C20H25NO5 — CID 139247207
benzyl N-[(2R,3R)-2-hydroxy-3-(4-methoxyphenoxy)-2-methylbutyl]carbamate (PubChem CID 139247207) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is benzyl N-[(2R,3R)-2-hydroxy-3-(4-methoxyphenoxy)-2-methylbutyl]carbamate.
| Compound Name | benzyl N-[(2R,3R)-2-hydroxy-3-(4-methoxyphenoxy)-2-methylbutyl]carbamate |
|---|---|
| PubChem CID | 139247207 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | benzyl N-[(2R,3R)-2-hydroxy-3-(4-methoxyphenoxy)-2-methylbutyl]carbamate |
| SMILES | COc1ccc(O[C@H](C)[C@](C)(O)CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO5/c1-15(26-18-11-9-17(24-3)10-12-18)20(2,23)14-21-19(22)25-13-16-7-5-4-6-8-16/h4-12,15,23H,13-14H2,1-3H3,(H,21,22)/t15-,20-/m1/s1 |
| InChIKey | MPJPZRDEHPJMRT-FOIQADDNSA-N |
| XLogP | 3.14 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |