C17H18BrNO3 — CID 110291658
benzyl N-[2-(4-bromophenyl)-2-hydroxypropyl]carbamate (PubChem CID 110291658) has the molecular formula C17H18BrNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is benzyl N-[2-(4-bromophenyl)-2-hydroxypropyl]carbamate.
| Compound Name | benzyl N-[2-(4-bromophenyl)-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 110291658 |
| Molecular Formula | C17H18BrNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | benzyl N-[2-(4-bromophenyl)-2-hydroxypropyl]carbamate |
| SMILES | CC(O)(CNC(=O)OCc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrNO3/c1-17(21,14-7-9-15(18)10-8-14)12-19-16(20)22-11-13-5-3-2-4-6-13/h2-10,21H,11-12H2,1H3,(H,19,20) |
| InChIKey | VUWSFZMLDXONLZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |