C15H20BrNO3 — CID 104701872
benzyl N-(4-bromo-2-ethyl-2-methyl-3-oxobutyl)carbamate (PubChem CID 104701872) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is benzyl N-(4-bromo-2-ethyl-2-methyl-3-oxobutyl)carbamate.
| Compound Name | benzyl N-(4-bromo-2-ethyl-2-methyl-3-oxobutyl)carbamate |
|---|---|
| PubChem CID | 104701872 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | benzyl N-(4-bromo-2-ethyl-2-methyl-3-oxobutyl)carbamate |
| SMILES | CCC(C)(CNC(=O)OCc1ccccc1)C(=O)CBr |
| InChI | InChI=1S/C15H20BrNO3/c1-3-15(2,13(18)9-16)11-17-14(19)20-10-12-7-5-4-6-8-12/h4-8H,3,9-11H2,1-2H3,(H,17,19) |
| InChIKey | SBKNMRDRGDQWOV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|