C22H20F3NO4 — CID 45378628
methyl 5-(2-methylphenyl)-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)pent-4-ynoate (PubChem CID 45378628) has the molecular formula C22H20F3NO4 and a molecular weight of 419.40 g/mol. Its IUPAC name is methyl 5-(2-methylphenyl)-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)pent-4-ynoate.
| Compound Name | methyl 5-(2-methylphenyl)-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)pent-4-ynoate |
|---|---|
| PubChem CID | 45378628 |
| Molecular Formula | C22H20F3NO4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | methyl 5-(2-methylphenyl)-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)pent-4-ynoate |
| SMILES | COC(=O)C(CC#Cc1ccccc1C)(NC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H20F3NO4/c1-16-9-6-7-12-18(16)13-8-14-21(19(27)29-2,22(23,24)25)26-20(28)30-15-17-10-4-3-5-11-17/h3-7,9-12H,14-15H2,1-2H3,(H,26,28) |
| InChIKey | CRYFQXUCSQZWKA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|