C15H17F3N2O5 — CID 102119263
(2S)-6-amino-6-oxo-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)hexanoic acid (PubChem CID 102119263) has the molecular formula C15H17F3N2O5 and a molecular weight of 362.30 g/mol. Its IUPAC name is (2S)-6-amino-6-oxo-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)hexanoic acid.
| Compound Name | (2S)-6-amino-6-oxo-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)hexanoic acid |
|---|---|
| PubChem CID | 102119263 |
| Molecular Formula | C15H17F3N2O5 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (2S)-6-amino-6-oxo-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)hexanoic acid |
| SMILES | NC(=O)CCC[C@](NC(=O)OCc1ccccc1)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O5/c16-15(17,18)14(12(22)23,8-4-7-11(19)21)20-13(24)25-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H2,19,21)(H,20,24)(H,22,23)/t14-/m0/s1 |
| InChIKey | YUQZTUSHDZOPKO-AWEZNQCLSA-N |
| XLogP | 1.95 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |