C19H25F2NO5 — CID 54148954
5-cyclohexyl-2,2-difluoro-3-hydroxy-3-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 54148954) has the molecular formula C19H25F2NO5 and a molecular weight of 385.41 g/mol. Its IUPAC name is 5-cyclohexyl-2,2-difluoro-3-hydroxy-3-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-cyclohexyl-2,2-difluoro-3-hydroxy-3-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 54148954 |
| Molecular Formula | C19H25F2NO5 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 5-cyclohexyl-2,2-difluoro-3-hydroxy-3-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(NC(O)(CCC1CCCCC1)C(F)(F)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H25F2NO5/c20-19(21,16(23)24)18(26,12-11-14-7-3-1-4-8-14)22-17(25)27-13-15-9-5-2-6-10-15/h2,5-6,9-10,14,26H,1,3-4,7-8,11-13H2,(H,22,25)(H,23,24) |
| InChIKey | OGJQOIRJWQVNNW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|