C26H33NO4 — CID 46180296
methyl (2R)-2-benzyl-4-cyclohexyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 46180296) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is methyl (2R)-2-benzyl-4-cyclohexyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2R)-2-benzyl-4-cyclohexyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 46180296 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | methyl (2R)-2-benzyl-4-cyclohexyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)[C@@](CCC1CCCCC1)(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H33NO4/c1-30-24(28)26(19-22-13-7-3-8-14-22,18-17-21-11-5-2-6-12-21)27-25(29)31-20-23-15-9-4-10-16-23/h3-4,7-10,13-16,21H,2,5-6,11-12,17-20H2,1H3,(H,27,29)/t26-/m1/s1 |
| InChIKey | GSWJNHSFAWVLAN-AREMUKBSSA-N |
| XLogP | 5.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |