C41H39N3O14 — CID 57208633
(3S)-4-[2-amino-3-[(2S)-2-benzyl-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]oxy-3-oxopropanoyl]oxy-3-benzyl-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 57208633) has the molecular formula C41H39N3O14 and a molecular weight of 797.77 g/mol. Its IUPAC name is (3S)-4-[2-amino-3-[(2S)-2-benzyl-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]oxy-3-oxopropanoyl]oxy-3-benzyl-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (3S)-4-[2-amino-3-[(2S)-2-benzyl-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]oxy-3-oxopropanoyl]oxy-3-benzyl-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 57208633 |
| Molecular Formula | C41H39N3O14 |
| Molecular Weight | 797.77 g/mol |
| Exact Mass | 797.24 |
| IUPAC Name | (3S)-4-[2-amino-3-[(2S)-2-benzyl-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]oxy-3-oxopropanoyl]oxy-3-benzyl-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | NC(C(=O)OC(=O)[C@@](CC(=O)O)(Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)OC(=O)[C@@](CC(=O)O)(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H39N3O14/c42-33(34(49)57-36(51)40(23-31(45)46,21-27-13-5-1-6-14-27)43-38(53)55-25-29-17-9-3-10-18-29)35(50)58-37(52)41(24-32(47)48,22-28-15-7-2-8-16-28)44-39(54)56-26-30-19-11-4-12-20-30/h1-20,33H,21-26,42H2,(H,43,53)(H,44,54)(H,45,46)(H,47,48)/t40-,41-/m0/s1 |
| InChIKey | RHQYIFCDDVAIDM-YATWDLPUSA-N |
| XLogP | 3.22 |
| TPSA | 264.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|