C14H14F3NO4 — CID 14561229
methyl 2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)but-3-enoate (PubChem CID 14561229) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is methyl 2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)but-3-enoate.
| Compound Name | methyl 2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)but-3-enoate |
|---|---|
| PubChem CID | 14561229 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | methyl 2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)but-3-enoate |
| SMILES | C=CC(NC(=O)OCc1ccccc1)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO4/c1-3-13(11(19)21-2,14(15,16)17)18-12(20)22-9-10-7-5-4-6-8-10/h3-8H,1,9H2,2H3,(H,18,20) |
| InChIKey | ADWHPWIWBDGZRI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|