C22H24F3NO7S — CID 121398935
(2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)-2-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]butanoic acid (PubChem CID 121398935) has the molecular formula C22H24F3NO7S and a molecular weight of 503.50 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)-2-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)-2-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 121398935 |
| Molecular Formula | C22H24F3NO7S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)-2-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]butanoic acid |
| SMILES | CC(C)(C)[C@](Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1)(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H24F3NO7S/c1-20(2,3)21(18(27)28,26-19(29)32-14-16-7-5-4-6-8-16)13-15-9-11-17(12-10-15)33-34(30,31)22(23,24)25/h4-12H,13-14H2,1-3H3,(H,26,29)(H,27,28)/t21-/m1/s1 |
| InChIKey | VGYIBMODKRWKKZ-OAQYLSRUSA-N |
| XLogP | 4.25 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|