C19H11F3O3 — CID 134943720
ethyl (2R)-2-hydroxy-10-phenyl-2-(trifluoromethyl)deca-3,5,7,9-tetraynoate (PubChem CID 134943720) has the molecular formula C19H11F3O3 and a molecular weight of 344.29 g/mol. Its IUPAC name is ethyl (2R)-2-hydroxy-10-phenyl-2-(trifluoromethyl)deca-3,5,7,9-tetraynoate.
| Compound Name | ethyl (2R)-2-hydroxy-10-phenyl-2-(trifluoromethyl)deca-3,5,7,9-tetraynoate |
|---|---|
| PubChem CID | 134943720 |
| Molecular Formula | C19H11F3O3 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | ethyl (2R)-2-hydroxy-10-phenyl-2-(trifluoromethyl)deca-3,5,7,9-tetraynoate |
| SMILES | CCOC(=O)[C@](O)(C#CC#CC#CC#Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H11F3O3/c1-2-25-17(23)18(24,19(20,21)22)15-11-6-4-3-5-8-12-16-13-9-7-10-14-16/h7,9-10,13-14,24H,2H2,1H3/t18-/m1/s1 |
| InChIKey | NPMWVYRYUXWJKP-GOSISDBHSA-N |
| XLogP | 1.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|