C22H17BrF3NO3 — CID 102294051
ethyl 6-(4-bromophenyl)-2-(2-methoxyanilino)-2-(trifluoromethyl)hexa-3,5-diynoate (PubChem CID 102294051) has the molecular formula C22H17BrF3NO3 and a molecular weight of 480.28 g/mol. Its IUPAC name is ethyl 6-(4-bromophenyl)-2-(2-methoxyanilino)-2-(trifluoromethyl)hexa-3,5-diynoate.
| Compound Name | ethyl 6-(4-bromophenyl)-2-(2-methoxyanilino)-2-(trifluoromethyl)hexa-3,5-diynoate |
|---|---|
| PubChem CID | 102294051 |
| Molecular Formula | C22H17BrF3NO3 |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | ethyl 6-(4-bromophenyl)-2-(2-methoxyanilino)-2-(trifluoromethyl)hexa-3,5-diynoate |
| SMILES | CCOC(=O)C(C#CC#Cc1ccc(Br)cc1)(Nc1ccccc1OC)C(F)(F)F |
| InChI | InChI=1S/C22H17BrF3NO3/c1-3-30-20(28)21(22(24,25)26,27-18-9-4-5-10-19(18)29-2)15-7-6-8-16-11-13-17(23)14-12-16/h4-5,9-14,27H,3H2,1-2H3 |
| InChIKey | QYEPQZREEUFLBZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|