C17H20O3 — CID 11471271
ethyl (E)-6-hydroxy-2-methyl-2-(2-phenylethynyl)hex-4-enoate (PubChem CID 11471271) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is ethyl (E)-6-hydroxy-2-methyl-2-(2-phenylethynyl)hex-4-enoate.
| Compound Name | ethyl (E)-6-hydroxy-2-methyl-2-(2-phenylethynyl)hex-4-enoate |
|---|---|
| PubChem CID | 11471271 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | ethyl (E)-6-hydroxy-2-methyl-2-(2-phenylethynyl)hex-4-enoate |
| SMILES | CCOC(=O)C(C)(C#Cc1ccccc1)C/C=C/CO |
| InChI | InChI=1S/C17H20O3/c1-3-20-16(19)17(2,12-7-8-14-18)13-11-15-9-5-4-6-10-15/h4-10,18H,3,12,14H2,1-2H3/b8-7+ |
| InChIKey | BHVWINUGNGBCHW-BQYQJAHWSA-N |
| XLogP | 2.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|