C23H36O2 — CID 159438295
1-tert-butyl-4-(3,3-dimethylbut-1-ynyl)benzene;ethyl 2,2-dimethylpropanoate (PubChem CID 159438295) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,3-dimethylbut-1-ynyl)benzene;ethyl 2,2-dimethylpropanoate.
| Compound Name | 1-tert-butyl-4-(3,3-dimethylbut-1-ynyl)benzene;ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159438295 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 1-tert-butyl-4-(3,3-dimethylbut-1-ynyl)benzene;ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C#Cc1ccc(C(C)(C)C)cc1.CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H22.C7H14O2/c1-15(2,3)12-11-13-7-9-14(10-8-13)16(4,5)6;1-5-9-6(8)7(2,3)4/h7-10H,1-6H3;5H2,1-4H3 |
| InChIKey | LRVVKBQSBWENTB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|