C10H12F6NO6P — CID 10548241
[(E)-N-(diethoxyphosphorylmethyl)-C-(2,2,2-trifluoroacetyl)carbonimidoyl] 2,2,2-trifluoroacetate (PubChem CID 10548241) has the molecular formula C10H12F6NO6P and a molecular weight of 387.17 g/mol. Its IUPAC name is [(E)-N-(diethoxyphosphorylmethyl)-C-(2,2,2-trifluoroacetyl)carbonimidoyl] 2,2,2-trifluoroacetate.
| Compound Name | [(E)-N-(diethoxyphosphorylmethyl)-C-(2,2,2-trifluoroacetyl)carbonimidoyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10548241 |
| Molecular Formula | C10H12F6NO6P |
| Molecular Weight | 387.17 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | [(E)-N-(diethoxyphosphorylmethyl)-C-(2,2,2-trifluoroacetyl)carbonimidoyl] 2,2,2-trifluoroacetate |
| SMILES | CCOP(=O)(C/N=C(/OC(=O)C(F)(F)F)C(=O)C(F)(F)F)OCC |
| InChI | InChI=1S/C10H12F6NO6P/c1-3-21-24(20,22-4-2)5-17-7(6(18)9(11,12)13)23-8(19)10(14,15)16/h3-5H2,1-2H3/b17-7+ |
| InChIKey | OSJIUVODUGNETF-REZTVBANSA-N |
| XLogP | 2.85 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|