C11H19F3NO6P — CID 101030133
ethyl 3-diethoxyphosphoryl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 101030133) has the molecular formula C11H19F3NO6P and a molecular weight of 349.24 g/mol. Its IUPAC name is ethyl 3-diethoxyphosphoryl-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | ethyl 3-diethoxyphosphoryl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 101030133 |
| Molecular Formula | C11H19F3NO6P |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | ethyl 3-diethoxyphosphoryl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CCOC(=O)C(CP(=O)(OCC)OCC)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3NO6P/c1-4-19-9(16)8(15-10(17)11(12,13)14)7-22(18,20-5-2)21-6-3/h8H,4-7H2,1-3H3,(H,15,17) |
| InChIKey | SQFQVFIJESUPSD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|