C8H10F3NO4 — CID 13313510
ethyl (2S)-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoate (PubChem CID 13313510) has the molecular formula C8H10F3NO4 and a molecular weight of 241.16 g/mol. Its IUPAC name is ethyl (2S)-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoate.
| Compound Name | ethyl (2S)-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
|---|---|
| PubChem CID | 13313510 |
| Molecular Formula | C8H10F3NO4 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | ethyl (2S)-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
| SMILES | CCOC(=O)[C@H](CC=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO4/c1-2-16-6(14)5(3-4-13)12-7(15)8(9,10)11/h4-5H,2-3H2,1H3,(H,12,15)/t5-/m0/s1 |
| InChIKey | RUKOAHANEXSFST-YFKPBYRVSA-N |
| XLogP | 0.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|