methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate

C9H15F3N2O3 — CID 102385977

IUPACmethyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate
SMILESCOC(=O)[C@H](CCC(C)N)NC(=O)C(F)(F)F
InChIInChI=1S/C9H15F3N2O3/c1-5(13)3-4-6(7(15)17-2)14-8(16)9(10,11)12/h5-6H,3-4,13H2,1-2H3,(H,14,16)/t5?,6-/m0/s1
InChIKeyORRRMJRKFVNSGS-GDVGLLTNSA-N
MW256.22 g/mol
LogP0.33
Rot. Bonds5

About methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate

methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 102385977) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.

Molecular Properties

Compound Namemethyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate
PubChem CID102385977
Molecular FormulaC9H15F3N2O3
Molecular Weight256.22 g/mol
Exact Mass256.10
IUPAC Namemethyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate
SMILESCOC(=O)[C@H](CCC(C)N)NC(=O)C(F)(F)F
InChIInChI=1S/C9H15F3N2O3/c1-5(13)3-4-6(7(15)17-2)14-8(16)9(10,11)12/h5-6H,3-4,13H2,1-2H3,(H,14,16)/t5?,6-/m0/s1
InChIKeyORRRMJRKFVNSGS-GDVGLLTNSA-N
XLogP0.33
TPSA81.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.22
LogP ≤ 50.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
The IUPAC name of methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (CID 102385977) is methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.
What is the SMILES notation for methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
The canonical SMILES for methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate is COC(=O)[C@H](CCC(C)N)NC(=O)C(F)(F)F.
What is the InChIKey of methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
The InChIKey is ORRRMJRKFVNSGS-GDVGLLTNSA-N. The full InChI is InChI=1S/C9H15F3N2O3/c1-5(13)3-4-6(7(15)17-2)14-8(16)9(10,11)12/h5-6H,3-4,13H2,1-2H3,(H,14,16)/t5?,6-/m0/s1.
What are the key properties of methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate has a molecular weight of 256.22 g/mol, XLogP of 0.33, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-5-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate is sourced from PubChem (CID 102385977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).