C15H24F3NO5 — CID 545467
dibutan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]pentanedioate (PubChem CID 545467) has the molecular formula C15H24F3NO5 and a molecular weight of 355.35 g/mol. Its IUPAC name is dibutan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]pentanedioate.
| Compound Name | dibutan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]pentanedioate |
|---|---|
| PubChem CID | 545467 |
| Molecular Formula | C15H24F3NO5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | dibutan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]pentanedioate |
| SMILES | CCC(C)OC(=O)CCC(NC(=O)C(F)(F)F)C(=O)OC(C)CC |
| InChI | InChI=1S/C15H24F3NO5/c1-5-9(3)23-12(20)8-7-11(13(21)24-10(4)6-2)19-14(22)15(16,17)18/h9-11H,5-8H2,1-4H3,(H,19,22) |
| InChIKey | FXJCMDFPJGLPRJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |