C14H16F3NO2S — CID 10870888
N-benzyl-1,1,1-trifluoro-N-hex-3-yn-2-ylmethanesulfonamide (PubChem CID 10870888) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is N-benzyl-1,1,1-trifluoro-N-hex-3-yn-2-ylmethanesulfonamide.
| Compound Name | N-benzyl-1,1,1-trifluoro-N-hex-3-yn-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 10870888 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-benzyl-1,1,1-trifluoro-N-hex-3-yn-2-ylmethanesulfonamide |
| SMILES | CCC#CC(C)N(Cc1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2S/c1-3-4-8-12(2)18(21(19,20)14(15,16)17)11-13-9-6-5-7-10-13/h5-7,9-10,12H,3,11H2,1-2H3 |
| InChIKey | BDFJGAJCPDAQPO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|