About CID 154102702
CID 154102702 (PubChem CID 154102702) has the molecular formula H3N3O5S
and a molecular weight of 157.11 g/mol.
Molecular Properties
| Compound Name | CID 154102702 |
| PubChem CID | 154102702 |
| Molecular Formula | H3N3O5S |
| Molecular Weight | 157.11 g/mol |
| Exact Mass | 156.98 |
| IUPAC Name | — |
| SMILES | NS(=O)(=O)N(O)[N+](=O)[O-] |
| InChI | InChI=1S/H3N3O5S/c1-9(7,8)3(6)2(4)5/h6H,(H2,1,7,8) |
| InChIKey | VZLPLVYTLCNSNN-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.11 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 154102702 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154102702?
The IUPAC name of CID 154102702 (CID 154102702) is not available.
What is the SMILES notation for CID 154102702?
The canonical SMILES for CID 154102702 is NS(=O)(=O)N(O)[N+](=O)[O-].
What is the InChIKey of CID 154102702?
The InChIKey is VZLPLVYTLCNSNN-UHFFFAOYSA-N. The full InChI is InChI=1S/H3N3O5S/c1-9(7,8)3(6)2(4)5/h6H,(H2,1,7,8).
What are the key properties of CID 154102702?
CID 154102702 has a molecular weight of 157.11 g/mol, XLogP of -1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154102702 is sourced from PubChem (CID 154102702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).