C4HF9O3S — CID 59383760
1,1,1,2,2,3,4,4,4-nonafluoro-3-(trioxidanylsulfanyl)butane (PubChem CID 59383760) has the molecular formula C4HF9O3S and a molecular weight of 300.10 g/mol. Its IUPAC name is 1,1,1,2,2,3,4,4,4-nonafluoro-3-(trioxidanylsulfanyl)butane.
| Compound Name | 1,1,1,2,2,3,4,4,4-nonafluoro-3-(trioxidanylsulfanyl)butane |
|---|---|
| PubChem CID | 59383760 |
| Molecular Formula | C4HF9O3S |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | 1,1,1,2,2,3,4,4,4-nonafluoro-3-(trioxidanylsulfanyl)butane |
| SMILES | OOOSC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF9O3S/c5-1(6,3(8,9)10)2(7,4(11,12)13)17-16-15-14/h14H |
| InChIKey | LDBYUUCTXGNCLC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|