C6F14S — CID 12642879
1,1,1,2,3,3,3-heptafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)propane (PubChem CID 12642879) has the molecular formula C6F14S and a molecular weight of 370.11 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)propane.
| Compound Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)propane |
|---|---|
| PubChem CID | 12642879 |
| Molecular Formula | C6F14S |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)propane |
| SMILES | FC(F)(F)C(F)(SC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F14S/c7-1(3(9,10)11,4(12,13)14)21-2(8,5(15,16)17)6(18,19)20 |
| InChIKey | WITFHNVTIQQIKM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |