C8F18S2 — CID 138977229
2,3-bis[difluoro(trifluoromethylsulfanyl)methyl]-1,1,1,2,3,4,4,4-octafluorobutane (PubChem CID 138977229) has the molecular formula C8F18S2 and a molecular weight of 502.19 g/mol. Its IUPAC name is 2,3-bis[difluoro(trifluoromethylsulfanyl)methyl]-1,1,1,2,3,4,4,4-octafluorobutane.
| Compound Name | 2,3-bis[difluoro(trifluoromethylsulfanyl)methyl]-1,1,1,2,3,4,4,4-octafluorobutane |
|---|---|
| PubChem CID | 138977229 |
| Molecular Formula | C8F18S2 |
| Molecular Weight | 502.19 g/mol |
| Exact Mass | 501.92 |
| IUPAC Name | 2,3-bis[difluoro(trifluoromethylsulfanyl)methyl]-1,1,1,2,3,4,4,4-octafluorobutane |
| SMILES | FC(F)(F)SC(F)(F)C(F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)SC(F)(F)F |
| InChI | InChI=1S/C8F18S2/c9-1(3(11,12)13,5(17,18)27-7(21,22)23)2(10,4(14,15)16)6(19,20)28-8(24,25)26 |
| InChIKey | HEXYCXQQJKIFPU-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.19 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |