C6F15S+ — CID 87727294
tris(1,1,2,2,2-pentafluoroethyl)sulfanium (PubChem CID 87727294) has the molecular formula C6F15S+ and a molecular weight of 389.10 g/mol. Its IUPAC name is tris(1,1,2,2,2-pentafluoroethyl)sulfanium.
| Compound Name | tris(1,1,2,2,2-pentafluoroethyl)sulfanium |
|---|---|
| PubChem CID | 87727294 |
| Molecular Formula | C6F15S+ |
| Molecular Weight | 389.10 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | tris(1,1,2,2,2-pentafluoroethyl)sulfanium |
| SMILES | FC(F)(F)C(F)(F)[S+](C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F15S/c7-1(8,9)4(16,17)22(5(18,19)2(10,11)12)6(20,21)3(13,14)15/q+1 |
| InChIKey | FRLNTAZIHHZNDU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.10 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|