C9H15F4NO4S — CID 20734530
2,3,3,3-tetrafluoro-N-hexyl-2-(trioxidanylsulfanyl)propanamide (PubChem CID 20734530) has the molecular formula C9H15F4NO4S and a molecular weight of 309.28 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-N-hexyl-2-(trioxidanylsulfanyl)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-N-hexyl-2-(trioxidanylsulfanyl)propanamide |
|---|---|
| PubChem CID | 20734530 |
| Molecular Formula | C9H15F4NO4S |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2,3,3,3-tetrafluoro-N-hexyl-2-(trioxidanylsulfanyl)propanamide |
| SMILES | CCCCCCNC(=O)C(F)(SOOO)C(F)(F)F |
| InChI | InChI=1S/C9H15F4NO4S/c1-2-3-4-5-6-14-7(15)8(10,9(11,12)13)19-18-17-16/h16H,2-6H2,1H3,(H,14,15) |
| InChIKey | YMQVBLOFGLLREC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|