C4HF8O6S2- — CID 58795331
1,1,2,2,3,3,4,4-octafluoro-4-oxidoperoxysulfanylbutane-1-sulfonic acid (PubChem CID 58795331) has the molecular formula C4HF8O6S2- and a molecular weight of 361.16 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-4-oxidoperoxysulfanylbutane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-4-oxidoperoxysulfanylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 58795331 |
| Molecular Formula | C4HF8O6S2- |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 360.91 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-4-oxidoperoxysulfanylbutane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C4H2F8O6S2/c5-1(6,3(9,10)19-18-17-13)2(7,8)4(11,12)20(14,15)16/h13H,(H,14,15,16)/p-1 |
| InChIKey | QZKUUQFRBAFOPC-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|