C8H6F8O10S2 — CID 58616413
1,1,2,2-tetrafluoro-2-[4-oxo-4-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethoxy]butanoyl]oxyethanesulfonic acid (PubChem CID 58616413) has the molecular formula C8H6F8O10S2 and a molecular weight of 478.24 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[4-oxo-4-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethoxy]butanoyl]oxyethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[4-oxo-4-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethoxy]butanoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 58616413 |
| Molecular Formula | C8H6F8O10S2 |
| Molecular Weight | 478.24 g/mol |
| Exact Mass | 477.93 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[4-oxo-4-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethoxy]butanoyl]oxyethanesulfonic acid |
| SMILES | O=C(CCC(=O)OC(F)(F)C(F)(F)S(=O)(=O)O)OC(F)(F)C(F)(F)SOOO |
| InChI | InChI=1S/C8H6F8O10S2/c9-5(10,7(13,14)27-26-25-19)23-3(17)1-2-4(18)24-6(11,12)8(15,16)28(20,21)22/h19H,1-2H2,(H,20,21,22) |
| InChIKey | ZKTYTWKQZOSEAN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|