C5H3F9O4S — CID 14028422
1,1,2,2-tetrafluoro-2-(2,2,3,3,3-pentafluoropropoxy)ethanesulfonic acid (PubChem CID 14028422) has the molecular formula C5H3F9O4S and a molecular weight of 330.12 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(2,2,3,3,3-pentafluoropropoxy)ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(2,2,3,3,3-pentafluoropropoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 14028422 |
| Molecular Formula | C5H3F9O4S |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(2,2,3,3,3-pentafluoropropoxy)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F9O4S/c6-2(7,3(8,9)10)1-18-4(11,12)5(13,14)19(15,16)17/h1H2,(H,15,16,17) |
| InChIKey | XWTCTCSHOWWRRO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|