C7H11F5O9S2 — CID 102271263
[2-methyl-2-(2,2,3,3,3-pentafluoropropoxy)-3-sulfooxypropyl] hydrogen sulfate (PubChem CID 102271263) has the molecular formula C7H11F5O9S2 and a molecular weight of 398.28 g/mol. Its IUPAC name is [2-methyl-2-(2,2,3,3,3-pentafluoropropoxy)-3-sulfooxypropyl] hydrogen sulfate.
| Compound Name | [2-methyl-2-(2,2,3,3,3-pentafluoropropoxy)-3-sulfooxypropyl] hydrogen sulfate |
|---|---|
| PubChem CID | 102271263 |
| Molecular Formula | C7H11F5O9S2 |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | [2-methyl-2-(2,2,3,3,3-pentafluoropropoxy)-3-sulfooxypropyl] hydrogen sulfate |
| SMILES | CC(COS(=O)(=O)O)(COS(=O)(=O)O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H11F5O9S2/c1-5(2-20-22(13,14)15,3-21-23(16,17)18)19-4-6(8,9)7(10,11)12/h2-4H2,1H3,(H,13,14,15)(H,16,17,18) |
| InChIKey | GWSRXLPUCUYHDE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|