C6H9F3O9S2-2 — CID 102271265
[2-methyl-3-sulfonatooxy-2-(2,2,2-trifluoroethoxy)propyl] sulfate (PubChem CID 102271265) has the molecular formula C6H9F3O9S2-2 and a molecular weight of 346.26 g/mol. Its IUPAC name is [2-methyl-3-sulfonatooxy-2-(2,2,2-trifluoroethoxy)propyl] sulfate.
| Compound Name | [2-methyl-3-sulfonatooxy-2-(2,2,2-trifluoroethoxy)propyl] sulfate |
|---|---|
| PubChem CID | 102271265 |
| Molecular Formula | C6H9F3O9S2-2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | [2-methyl-3-sulfonatooxy-2-(2,2,2-trifluoroethoxy)propyl] sulfate |
| SMILES | CC(COS(=O)(=O)[O-])(COS(=O)(=O)[O-])OCC(F)(F)F |
| InChI | InChI=1S/C6H11F3O9S2/c1-5(2-17-19(10,11)12,3-18-20(13,14)15)16-4-6(7,8)9/h2-4H2,1H3,(H,10,11,12)(H,13,14,15)/p-2 |
| InChIKey | VTOKYKKXQMPZCC-UHFFFAOYSA-L |
| XLogP | -0.72 |
| TPSA | 142.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|