C7H18NO6RfS- — CID 169425349
azanium;[2-(methanidyloxymethyl)-3-methoxy-2-methylpropyl] sulfate;rutherfordium (PubChem CID 169425349) has the molecular formula C7H18NO6RfS- and a molecular weight of 511.29 g/mol. Its IUPAC name is azanium;[2-(methanidyloxymethyl)-3-methoxy-2-methylpropyl] sulfate;rutherfordium.
| Compound Name | azanium;[2-(methanidyloxymethyl)-3-methoxy-2-methylpropyl] sulfate;rutherfordium |
|---|---|
| PubChem CID | 169425349 |
| Molecular Formula | C7H18NO6RfS- |
| Molecular Weight | 511.29 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | azanium;[2-(methanidyloxymethyl)-3-methoxy-2-methylpropyl] sulfate;rutherfordium |
| SMILES | [CH2-]OCC(C)(COC)COS(=O)(=O)[O-].[NH4+].[Rf] |
| InChI | InChI=1S/C7H15O6S.H3N.Rf/c1-7(4-11-2,5-12-3)6-13-14(8,9)10;;/h2,4-6H2,1,3H3,(H,8,9,10);1H3;/q-1;; |
| InChIKey | DVFDVFQNBJFEMC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|