C21H35F10NO12S2 — CID 123819805
[2-[[3-[2-[(hydroxyazaniumyl)sulfonyloxymethyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propyl] sulfate (PubChem CID 123819805) has the molecular formula C21H35F10NO12S2 and a molecular weight of 747.62 g/mol. Its IUPAC name is [2-[[3-[2-[(hydroxyazaniumyl)sulfonyloxymethyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propyl] sulfate.
| Compound Name | [2-[[3-[2-[(hydroxyazaniumyl)sulfonyloxymethyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propyl] sulfate |
|---|---|
| PubChem CID | 123819805 |
| Molecular Formula | C21H35F10NO12S2 |
| Molecular Weight | 747.62 g/mol |
| Exact Mass | 747.14 |
| IUPAC Name | [2-[[3-[2-[(hydroxyazaniumyl)sulfonyloxymethyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propyl] sulfate |
| SMILES | CC(C)(COCC(C)(COCC(F)(F)C(F)(F)F)COS(=O)(=O)[O-])COCC(C)(COCC(F)(F)C(F)(F)F)COS(=O)(=O)[NH2+]O |
| InChI | InChI=1S/C21H35F10NO12S2/c1-15(2,6-40-8-17(4,12-44-46(36,37)38)10-42-14-19(24,25)21(29,30)31)5-39-7-16(3,11-43-45(34,35)32-33)9-41-13-18(22,23)20(26,27)28/h32-33H,5-14H2,1-4H3,(H,36,37,38) |
| InChIKey | HLANMGZMNBQBDF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 183.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|