C9H13F2NO — CID 158229007
6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one (PubChem CID 158229007) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one.
| Compound Name | 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one |
|---|---|
| PubChem CID | 158229007 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one |
| SMILES | CC(C)C(=O)C#CC(F)(F)N(C)C |
| InChI | InChI=1S/C9H13F2NO/c1-7(2)8(13)5-6-9(10,11)12(3)4/h7H,1-4H3 |
| InChIKey | KFHJOBFEGCHLDI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|