About 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one
6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one (PubChem CID 158229007) has the molecular formula C9H13F2NO
and a molecular weight of 189.20 g/mol. Its IUPAC name is 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one.
Molecular Properties
| Compound Name | 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one |
| PubChem CID | 158229007 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one |
| SMILES | CC(C)C(=O)C#CC(F)(F)N(C)C |
| InChI | InChI=1S/C9H13F2NO/c1-7(2)8(13)5-6-9(10,11)12(3)4/h7H,1-4H3 |
| InChIKey | KFHJOBFEGCHLDI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one?
The IUPAC name of 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one (CID 158229007) is 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one.
What is the SMILES notation for 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one?
The canonical SMILES for 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one is CC(C)C(=O)C#CC(F)(F)N(C)C.
What is the InChIKey of 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one?
The InChIKey is KFHJOBFEGCHLDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO/c1-7(2)8(13)5-6-9(10,11)12(3)4/h7H,1-4H3.
What are the key properties of 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one?
6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one has a molecular weight of 189.20 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-6,6-difluoro-2-methylhex-4-yn-3-one is sourced from PubChem (CID 158229007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).