About (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one
(E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one (PubChem CID 156888521) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one.
Molecular Properties
| Compound Name | (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one |
| PubChem CID | 156888521 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one |
| SMILES | CC#CC(=O)C(C)C.CC(C)C(=O)/C=C/N(C)C |
| InChI | InChI=1S/C8H15NO.C7H10O/c1-7(2)8(10)5-6-9(3)4;1-4-5-7(8)6(2)3/h5-7H,1-4H3;6H,1-3H3/b6-5+; |
| InChIKey | HSSUFVIQAMHQCS-IPZCTEOASA-N |
| XLogP | 2.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one?
The IUPAC name of (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one (CID 156888521) is (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one.
What is the SMILES notation for (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one?
The canonical SMILES for (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one is CC#CC(=O)C(C)C.CC(C)C(=O)/C=C/N(C)C.
What is the InChIKey of (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one?
The InChIKey is HSSUFVIQAMHQCS-IPZCTEOASA-N. The full InChI is InChI=1S/C8H15NO.C7H10O/c1-7(2)8(10)5-6-9(3)4;1-4-5-7(8)6(2)3/h5-7H,1-4H3;6H,1-3H3/b6-5+;.
What are the key properties of (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one?
(E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one has a molecular weight of 251.37 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(dimethylamino)-4-methylpent-1-en-3-one;2-methylhex-4-yn-3-one is sourced from PubChem (CID 156888521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).