C7H6F7NO — CID 12661114
2,4,4,4-tetrafluoro-N,N-dimethyl-3-(trifluoromethyl)but-2-enamide (PubChem CID 12661114) has the molecular formula C7H6F7NO and a molecular weight of 253.12 g/mol. Its IUPAC name is 2,4,4,4-tetrafluoro-N,N-dimethyl-3-(trifluoromethyl)but-2-enamide.
| Compound Name | 2,4,4,4-tetrafluoro-N,N-dimethyl-3-(trifluoromethyl)but-2-enamide |
|---|---|
| PubChem CID | 12661114 |
| Molecular Formula | C7H6F7NO |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2,4,4,4-tetrafluoro-N,N-dimethyl-3-(trifluoromethyl)but-2-enamide |
| SMILES | CN(C)C(=O)C(F)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F7NO/c1-15(2)5(16)3(8)4(6(9,10)11)7(12,13)14/h1-2H3 |
| InChIKey | ABPCIJOYGPNEQP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|