About 3-amino-N,N-dimethyl-2-methylidenebutanamide
3-amino-N,N-dimethyl-2-methylidenebutanamide (PubChem CID 87194380) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-2-methylidenebutanamide.
Molecular Properties
| Compound Name | 3-amino-N,N-dimethyl-2-methylidenebutanamide |
| PubChem CID | 87194380 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3-amino-N,N-dimethyl-2-methylidenebutanamide |
| SMILES | C=C(C(=O)N(C)C)C(C)N |
| InChI | InChI=1S/C7H14N2O/c1-5(6(2)8)7(10)9(3)4/h6H,1,8H2,2-4H3 |
| InChIKey | FDGJEQQKECJXIA-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N,N-dimethyl-2-methylidenebutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-dimethyl-2-methylidenebutanamide?
The IUPAC name of 3-amino-N,N-dimethyl-2-methylidenebutanamide (CID 87194380) is 3-amino-N,N-dimethyl-2-methylidenebutanamide.
What is the SMILES notation for 3-amino-N,N-dimethyl-2-methylidenebutanamide?
The canonical SMILES for 3-amino-N,N-dimethyl-2-methylidenebutanamide is C=C(C(=O)N(C)C)C(C)N.
What is the InChIKey of 3-amino-N,N-dimethyl-2-methylidenebutanamide?
The InChIKey is FDGJEQQKECJXIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-5(6(2)8)7(10)9(3)4/h6H,1,8H2,2-4H3.
What are the key properties of 3-amino-N,N-dimethyl-2-methylidenebutanamide?
3-amino-N,N-dimethyl-2-methylidenebutanamide has a molecular weight of 142.20 g/mol, XLogP of -0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-dimethyl-2-methylidenebutanamide is sourced from PubChem (CID 87194380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).