C8H19ClN2O2 — CID 174987164
1-N',1-N'-dimethylethane-1,1-diamine;2-methylprop-2-enoic acid;hydrochloride (PubChem CID 174987164) has the molecular formula C8H19ClN2O2 and a molecular weight of 210.70 g/mol. Its IUPAC name is 1-N',1-N'-dimethylethane-1,1-diamine;2-methylprop-2-enoic acid;hydrochloride.
| Compound Name | 1-N',1-N'-dimethylethane-1,1-diamine;2-methylprop-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 174987164 |
| Molecular Formula | C8H19ClN2O2 |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-N',1-N'-dimethylethane-1,1-diamine;2-methylprop-2-enoic acid;hydrochloride |
| SMILES | C=C(C)C(=O)O.CC(N)N(C)C.Cl |
| InChI | InChI=1S/C4H12N2.C4H6O2.ClH/c1-4(5)6(2)3;1-3(2)4(5)6;/h4H,5H2,1-3H3;1H2,2H3,(H,5,6);1H |
| InChIKey | XSRCRBPZSUWFDF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|