About 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride
1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride (PubChem CID 88669433) has the molecular formula C9H21ClN2O2
and a molecular weight of 224.73 g/mol. Its IUPAC name is 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride.
Molecular Properties
| Compound Name | 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride |
| PubChem CID | 88669433 |
| Molecular Formula | C9H21ClN2O2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride |
| SMILES | C=C(C)C(=O)O.CC(N)[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C5H15N2.C4H6O2.ClH/c1-5(6)7(2,3)4;1-3(2)4(5)6;/h5H,6H2,1-4H3;1H2,2H3,(H,5,6);1H/q+1;;/p-1 |
| InChIKey | YATXMJXPNATTBD-UHFFFAOYSA-M |
| XLogP | -2.35 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride?
The IUPAC name of 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride (CID 88669433) is 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride.
What is the SMILES notation for 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride?
The canonical SMILES for 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride is C=C(C)C(=O)O.CC(N)[N+](C)(C)C.[Cl-].
What is the InChIKey of 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride?
The InChIKey is YATXMJXPNATTBD-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H15N2.C4H6O2.ClH/c1-5(6)7(2,3)4;1-3(2)4(5)6;/h5H,6H2,1-4H3;1H2,2H3,(H,5,6);1H/q+1;;/p-1.
What are the key properties of 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride?
1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride has a molecular weight of 224.73 g/mol, XLogP of -2.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl(trimethyl)azanium;2-methylprop-2-enoic acid;chloride is sourced from PubChem (CID 88669433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).