C21H44N2O — CID 87882599
pentadecan-4-amine;N,N,2-trimethylprop-2-enamide (PubChem CID 87882599) has the molecular formula C21H44N2O and a molecular weight of 340.60 g/mol. Its IUPAC name is pentadecan-4-amine;N,N,2-trimethylprop-2-enamide.
| Compound Name | pentadecan-4-amine;N,N,2-trimethylprop-2-enamide |
|---|---|
| PubChem CID | 87882599 |
| Molecular Formula | C21H44N2O |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.35 |
| IUPAC Name | pentadecan-4-amine;N,N,2-trimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)C.CCCCCCCCCCCC(N)CCC |
| InChI | InChI=1S/C15H33N.C6H11NO/c1-3-5-6-7-8-9-10-11-12-14-15(16)13-4-2;1-5(2)6(8)7(3)4/h15H,3-14,16H2,1-2H3;1H2,2-4H3 |
| InChIKey | AHRKOEICELZUPN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|