About 5-hydroxyhex-3-yn-2-one
5-hydroxyhex-3-yn-2-one (PubChem CID 160903445) has the molecular formula C18H24O6
and a molecular weight of 336.38 g/mol. Its IUPAC name is 5-hydroxyhex-3-yn-2-one.
Molecular Properties
| Compound Name | 5-hydroxyhex-3-yn-2-one |
| PubChem CID | 160903445 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-hydroxyhex-3-yn-2-one |
| SMILES | CC(=O)C#CC(C)O.CC(=O)C#CC(C)O.CC(=O)C#CC(C)O |
| InChI | InChI=1S/3C6H8O2/c3*1-5(7)3-4-6(2)8/h3*5,7H,1-2H3 |
| InChIKey | SPUUQTYUXSJCQU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxyhex-3-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyhex-3-yn-2-one?
The IUPAC name of 5-hydroxyhex-3-yn-2-one (CID 160903445) is 5-hydroxyhex-3-yn-2-one.
What is the SMILES notation for 5-hydroxyhex-3-yn-2-one?
The canonical SMILES for 5-hydroxyhex-3-yn-2-one is CC(=O)C#CC(C)O.CC(=O)C#CC(C)O.CC(=O)C#CC(C)O.
What is the InChIKey of 5-hydroxyhex-3-yn-2-one?
The InChIKey is SPUUQTYUXSJCQU-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H8O2/c3*1-5(7)3-4-6(2)8/h3*5,7H,1-2H3.
What are the key properties of 5-hydroxyhex-3-yn-2-one?
5-hydroxyhex-3-yn-2-one has a molecular weight of 336.38 g/mol, XLogP of -0.12, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyhex-3-yn-2-one is sourced from PubChem (CID 160903445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).