About methyl 4-hydroxypent-2-ynoate
methyl 4-hydroxypent-2-ynoate (PubChem CID 10396859) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is methyl 4-hydroxypent-2-ynoate.
Molecular Properties
| Compound Name | methyl 4-hydroxypent-2-ynoate |
| PubChem CID | 10396859 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | methyl 4-hydroxypent-2-ynoate |
| SMILES | COC(=O)C#CC(C)O |
| InChI | InChI=1S/C6H8O3/c1-5(7)3-4-6(8)9-2/h5,7H,1-2H3 |
| InChIKey | PNTKYLCBVBGCHR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-hydroxypent-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hydroxypent-2-ynoate?
The IUPAC name of methyl 4-hydroxypent-2-ynoate (CID 10396859) is methyl 4-hydroxypent-2-ynoate.
What is the SMILES notation for methyl 4-hydroxypent-2-ynoate?
The canonical SMILES for methyl 4-hydroxypent-2-ynoate is COC(=O)C#CC(C)O.
What is the InChIKey of methyl 4-hydroxypent-2-ynoate?
The InChIKey is PNTKYLCBVBGCHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-5(7)3-4-6(8)9-2/h5,7H,1-2H3.
What are the key properties of methyl 4-hydroxypent-2-ynoate?
methyl 4-hydroxypent-2-ynoate has a molecular weight of 128.13 g/mol, XLogP of -0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxypent-2-ynoate is sourced from PubChem (CID 10396859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).