About ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one)
ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one) (PubChem CID 167666634) has the molecular formula C22H32O4
and a molecular weight of 360.49 g/mol. Its IUPAC name is ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one).
Molecular Properties
| Compound Name | ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one) |
| PubChem CID | 167666634 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one) |
| SMILES | CC(=O)C#CC(C)C.CC(=O)C#CC(C)C.CCOC(=O)C#CC(C)C |
| InChI | InChI=1S/C8H12O2.2C7H10O/c1-4-10-8(9)6-5-7(2)3;2*1-6(2)4-5-7(3)8/h7H,4H2,1-3H3;2*6H,1-3H3 |
| InChIKey | SSVOMOXCQFXRKG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one)?
The IUPAC name of ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one) (CID 167666634) is ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one).
What is the SMILES notation for ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one)?
The canonical SMILES for ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one) is CC(=O)C#CC(C)C.CC(=O)C#CC(C)C.CCOC(=O)C#CC(C)C.
What is the InChIKey of ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one)?
The InChIKey is SSVOMOXCQFXRKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2.2C7H10O/c1-4-10-8(9)6-5-7(2)3;2*1-6(2)4-5-7(3)8/h7H,4H2,1-3H3;2*6H,1-3H3.
What are the key properties of ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one)?
ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one) has a molecular weight of 360.49 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methylpent-2-ynoate;bis(5-methylhex-3-yn-2-one) is sourced from PubChem (CID 167666634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).