C15H26O6 — CID 140698039
ethyl (4S,5R)-6,6-dimethoxy-5-(3-methoxypropoxy)-4-methylhex-2-ynoate (PubChem CID 140698039) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl (4S,5R)-6,6-dimethoxy-5-(3-methoxypropoxy)-4-methylhex-2-ynoate.
| Compound Name | ethyl (4S,5R)-6,6-dimethoxy-5-(3-methoxypropoxy)-4-methylhex-2-ynoate |
|---|---|
| PubChem CID | 140698039 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | ethyl (4S,5R)-6,6-dimethoxy-5-(3-methoxypropoxy)-4-methylhex-2-ynoate |
| SMILES | CCOC(=O)C#C[C@H](C)[C@@H](OCCCOC)C(OC)OC |
| InChI | InChI=1S/C15H26O6/c1-6-20-13(16)9-8-12(2)14(15(18-4)19-5)21-11-7-10-17-3/h12,14-15H,6-7,10-11H2,1-5H3/t12-,14+/m0/s1 |
| InChIKey | RWNHFYMRCMDWFH-GXTWGEPZSA-N |
| XLogP | 1.23 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|