C8H6O2 — CID 45085430
octa-3,5-diyne-2,7-dione (PubChem CID 45085430) has the molecular formula C8H6O2 and a molecular weight of 134.13 g/mol. Its IUPAC name is octa-3,5-diyne-2,7-dione.
| Compound Name | octa-3,5-diyne-2,7-dione |
|---|---|
| PubChem CID | 45085430 |
| Molecular Formula | C8H6O2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | octa-3,5-diyne-2,7-dione |
| SMILES | CC(=O)C#CC#CC(C)=O |
| InChI | InChI=1S/C8H6O2/c1-7(9)5-3-4-6-8(2)10/h1-2H3 |
| InChIKey | GNIPZQAYKNGALN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|