[(2Z)-penta-2,4-dien-2-yl]boronic acid

C5H9BO2 — CID 89434988

IUPAC[(2Z)-penta-2,4-dien-2-yl]boronic acid
SMILESC=C/C=C(\C)B(O)O
InChIInChI=1S/C5H9BO2/c1-3-4-5(2)6(7)8/h3-4,7-8H,1H2,2H3/b5-4+
InChIKeyVWPRMUYDABMMEO-SNAWJCMRSA-N
MW111.94 g/mol
LogP0.13
Rot. Bonds2

About [(2Z)-penta-2,4-dien-2-yl]boronic acid

[(2Z)-penta-2,4-dien-2-yl]boronic acid (PubChem CID 89434988) has the molecular formula C5H9BO2 and a molecular weight of 111.94 g/mol. Its IUPAC name is [(2Z)-penta-2,4-dien-2-yl]boronic acid.

Molecular Properties

Compound Name[(2Z)-penta-2,4-dien-2-yl]boronic acid
PubChem CID89434988
Molecular FormulaC5H9BO2
Molecular Weight111.94 g/mol
Exact Mass112.07
IUPAC Name[(2Z)-penta-2,4-dien-2-yl]boronic acid
SMILESC=C/C=C(\C)B(O)O
InChIInChI=1S/C5H9BO2/c1-3-4-5(2)6(7)8/h3-4,7-8H,1H2,2H3/b5-4+
InChIKeyVWPRMUYDABMMEO-SNAWJCMRSA-N
XLogP0.13
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500111.94
LogP ≤ 50.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze [(2Z)-penta-2,4-dien-2-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2Z)-penta-2,4-dien-2-yl]boronic acid?
The IUPAC name of [(2Z)-penta-2,4-dien-2-yl]boronic acid (CID 89434988) is [(2Z)-penta-2,4-dien-2-yl]boronic acid.
What is the SMILES notation for [(2Z)-penta-2,4-dien-2-yl]boronic acid?
The canonical SMILES for [(2Z)-penta-2,4-dien-2-yl]boronic acid is C=C/C=C(\C)B(O)O.
What is the InChIKey of [(2Z)-penta-2,4-dien-2-yl]boronic acid?
The InChIKey is VWPRMUYDABMMEO-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H9BO2/c1-3-4-5(2)6(7)8/h3-4,7-8H,1H2,2H3/b5-4+.
What are the key properties of [(2Z)-penta-2,4-dien-2-yl]boronic acid?
[(2Z)-penta-2,4-dien-2-yl]boronic acid has a molecular weight of 111.94 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-penta-2,4-dien-2-yl]boronic acid is sourced from PubChem (CID 89434988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).